About 1,4-dioxaspiro[4.6]undeca-6,8,10-triene
1,4-dioxaspiro[4.6]undeca-6,8,10-triene (PubChem CID 11469161) has the molecular formula C9H10O2
and a molecular weight of 150.18 g/mol. Its IUPAC name is 1,4-dioxaspiro[4.6]undeca-6,8,10-triene.
Molecular Properties
| Compound Name | 1,4-dioxaspiro[4.6]undeca-6,8,10-triene |
| PubChem CID | 11469161 |
| Molecular Formula | C9H10O2 |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.07 |
| IUPAC Name | 1,4-dioxaspiro[4.6]undeca-6,8,10-triene |
| SMILES | C1=CC=CC2(C=C1)OCCO2 |
| InChI | InChI=1S/C9H10O2/c1-2-4-6-9(5-3-1)10-7-8-11-9/h1-6H,7-8H2 |
| InChIKey | HZTPUMZZXMIRMY-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,4-dioxaspiro[4.6]undeca-6,8,10-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dioxaspiro[4.6]undeca-6,8,10-triene?
The IUPAC name of 1,4-dioxaspiro[4.6]undeca-6,8,10-triene (CID 11469161) is 1,4-dioxaspiro[4.6]undeca-6,8,10-triene.
What is the SMILES notation for 1,4-dioxaspiro[4.6]undeca-6,8,10-triene?
The canonical SMILES for 1,4-dioxaspiro[4.6]undeca-6,8,10-triene is C1=CC=CC2(C=C1)OCCO2.
What is the InChIKey of 1,4-dioxaspiro[4.6]undeca-6,8,10-triene?
The InChIKey is HZTPUMZZXMIRMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O2/c1-2-4-6-9(5-3-1)10-7-8-11-9/h1-6H,7-8H2.
What are the key properties of 1,4-dioxaspiro[4.6]undeca-6,8,10-triene?
1,4-dioxaspiro[4.6]undeca-6,8,10-triene has a molecular weight of 150.18 g/mol, XLogP of 1.41, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dioxaspiro[4.6]undeca-6,8,10-triene is sourced from PubChem (CID 11469161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).