C9H12Br2N2O — CID 114692402
3,5-dibromo-1-(oxan-2-ylmethyl)pyrazole (PubChem CID 114692402) has the molecular formula C9H12Br2N2O and a molecular weight of 324.02 g/mol. Its IUPAC name is 3,5-dibromo-1-(oxan-2-ylmethyl)pyrazole.
| Compound Name | 3,5-dibromo-1-(oxan-2-ylmethyl)pyrazole |
|---|---|
| PubChem CID | 114692402 |
| Molecular Formula | C9H12Br2N2O |
| Molecular Weight | 324.02 g/mol |
| Exact Mass | 321.93 |
| IUPAC Name | 3,5-dibromo-1-(oxan-2-ylmethyl)pyrazole |
| SMILES | Brc1cc(Br)n(CC2CCCCO2)n1 |
| InChI | InChI=1S/C9H12Br2N2O/c10-8-5-9(11)13(12-8)6-7-3-1-2-4-14-7/h5,7H,1-4,6H2 |
| InChIKey | XOXIHULNDUMWMB-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.02 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |