About 5-[(3,5-dibromopyrazol-1-yl)methyl]-1,3-oxazolidin-2-one
5-[(3,5-dibromopyrazol-1-yl)methyl]-1,3-oxazolidin-2-one (PubChem CID 114692672) has the molecular formula C7H7Br2N3O2
and a molecular weight of 324.96 g/mol. Its IUPAC name is 5-[(3,5-dibromopyrazol-1-yl)methyl]-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 5-[(3,5-dibromopyrazol-1-yl)methyl]-1,3-oxazolidin-2-one |
| PubChem CID | 114692672 |
| Molecular Formula | C7H7Br2N3O2 |
| Molecular Weight | 324.96 g/mol |
| Exact Mass | 322.89 |
| IUPAC Name | 5-[(3,5-dibromopyrazol-1-yl)methyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1NCC(Cn2nc(Br)cc2Br)O1 |
| InChI | InChI=1S/C7H7Br2N3O2/c8-5-1-6(9)12(11-5)3-4-2-10-7(13)14-4/h1,4H,2-3H2,(H,10,13) |
| InChIKey | UCBQEHHTHDXJID-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.96 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[(3,5-dibromopyrazol-1-yl)methyl]-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3,5-dibromopyrazol-1-yl)methyl]-1,3-oxazolidin-2-one?
The IUPAC name of 5-[(3,5-dibromopyrazol-1-yl)methyl]-1,3-oxazolidin-2-one (CID 114692672) is 5-[(3,5-dibromopyrazol-1-yl)methyl]-1,3-oxazolidin-2-one.
What is the SMILES notation for 5-[(3,5-dibromopyrazol-1-yl)methyl]-1,3-oxazolidin-2-one?
The canonical SMILES for 5-[(3,5-dibromopyrazol-1-yl)methyl]-1,3-oxazolidin-2-one is O=C1NCC(Cn2nc(Br)cc2Br)O1.
What is the InChIKey of 5-[(3,5-dibromopyrazol-1-yl)methyl]-1,3-oxazolidin-2-one?
The InChIKey is UCBQEHHTHDXJID-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7Br2N3O2/c8-5-1-6(9)12(11-5)3-4-2-10-7(13)14-4/h1,4H,2-3H2,(H,10,13).
What are the key properties of 5-[(3,5-dibromopyrazol-1-yl)methyl]-1,3-oxazolidin-2-one?
5-[(3,5-dibromopyrazol-1-yl)methyl]-1,3-oxazolidin-2-one has a molecular weight of 324.96 g/mol, XLogP of 1.52, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3,5-dibromopyrazol-1-yl)methyl]-1,3-oxazolidin-2-one is sourced from PubChem (CID 114692672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).