About ethyl 2-bromoacetate
ethyl 2-bromoacetate (PubChem CID 11469294) has the molecular formula C4H7BrO2
and a molecular weight of 167.99 g/mol. Its IUPAC name is ethyl 2-bromoacetate.
Molecular Properties
| Compound Name | ethyl 2-bromoacetate |
| PubChem CID | 11469294 |
| Molecular Formula | C4H7BrO2 |
| Molecular Weight | 167.99 g/mol |
| Exact Mass | 166.97 |
| IUPAC Name | ethyl 2-bromoacetate |
| SMILES | CCO[13C](=O)CBr |
| InChI | InChI=1S/C4H7BrO2/c1-2-7-4(6)3-5/h2-3H2,1H3/i4+1 |
| InChIKey | PQJJJMRNHATNKG-AZXPZELESA-N |
| XLogP | 0.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.99 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-bromoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-bromoacetate?
The IUPAC name of ethyl 2-bromoacetate (CID 11469294) is ethyl 2-bromoacetate.
What is the SMILES notation for ethyl 2-bromoacetate?
The canonical SMILES for ethyl 2-bromoacetate is CCO[13C](=O)CBr.
What is the InChIKey of ethyl 2-bromoacetate?
The InChIKey is PQJJJMRNHATNKG-AZXPZELESA-N. The full InChI is InChI=1S/C4H7BrO2/c1-2-7-4(6)3-5/h2-3H2,1H3/i4+1.
What are the key properties of ethyl 2-bromoacetate?
ethyl 2-bromoacetate has a molecular weight of 167.99 g/mol, XLogP of 0.94, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-bromoacetate is sourced from PubChem (CID 11469294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).