C10H16N2O — CID 114693610
N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)but-3-enamide (PubChem CID 114693610) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)but-3-enamide.
| Compound Name | N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)but-3-enamide |
|---|---|
| PubChem CID | 114693610 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)but-3-enamide |
| SMILES | C=CCC(=O)NCC1=CCNCC1 |
| InChI | InChI=1S/C10H16N2O/c1-2-3-10(13)12-8-9-4-6-11-7-5-9/h2,4,11H,1,3,5-8H2,(H,12,13) |
| InChIKey | QPWHWQCZTOLAMH-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|