C13H18N2OS — CID 114693690
4,5-dimethyl-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)thiophene-2-carboxamide (PubChem CID 114693690) has the molecular formula C13H18N2OS and a molecular weight of 250.37 g/mol. Its IUPAC name is 4,5-dimethyl-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)thiophene-2-carboxamide.
| Compound Name | 4,5-dimethyl-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 114693690 |
| Molecular Formula | C13H18N2OS |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 4,5-dimethyl-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)thiophene-2-carboxamide |
| SMILES | Cc1cc(C(=O)NCC2=CCNCC2)sc1C |
| InChI | InChI=1S/C13H18N2OS/c1-9-7-12(17-10(9)2)13(16)15-8-11-3-5-14-6-4-11/h3,7,14H,4-6,8H2,1-2H3,(H,15,16) |
| InChIKey | HUNPQICYSASNIZ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|