C7H11F3N2O2S — CID 114694187
1,1,1-trifluoro-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)methanesulfonamide (PubChem CID 114694187) has the molecular formula C7H11F3N2O2S and a molecular weight of 244.24 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)methanesulfonamide.
| Compound Name | 1,1,1-trifluoro-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)methanesulfonamide |
|---|---|
| PubChem CID | 114694187 |
| Molecular Formula | C7H11F3N2O2S |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | 1,1,1-trifluoro-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)methanesulfonamide |
| SMILES | O=S(=O)(NCC1=CCNCC1)C(F)(F)F |
| InChI | InChI=1S/C7H11F3N2O2S/c8-7(9,10)15(13,14)12-5-6-1-3-11-4-2-6/h1,11-12H,2-5H2 |
| InChIKey | RKTXUNNOHVKKDB-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.24 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|