C9H15N3O2S — CID 114694199
1-cyano-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)ethanesulfonamide (PubChem CID 114694199) has the molecular formula C9H15N3O2S and a molecular weight of 229.30 g/mol. Its IUPAC name is 1-cyano-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)ethanesulfonamide.
| Compound Name | 1-cyano-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)ethanesulfonamide |
|---|---|
| PubChem CID | 114694199 |
| Molecular Formula | C9H15N3O2S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 1-cyano-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)ethanesulfonamide |
| SMILES | CC(C#N)S(=O)(=O)NCC1=CCNCC1 |
| InChI | InChI=1S/C9H15N3O2S/c1-8(6-10)15(13,14)12-7-9-2-4-11-5-3-9/h2,8,11-12H,3-5,7H2,1H3 |
| InChIKey | GZQCFSXNDQLXSV-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|