C13H14ClN3 — CID 114694343
2-chloro-6-(1,2,3,6-tetrahydropyridin-4-ylmethylamino)benzonitrile (PubChem CID 114694343) has the molecular formula C13H14ClN3 and a molecular weight of 247.73 g/mol. Its IUPAC name is 2-chloro-6-(1,2,3,6-tetrahydropyridin-4-ylmethylamino)benzonitrile.
| Compound Name | 2-chloro-6-(1,2,3,6-tetrahydropyridin-4-ylmethylamino)benzonitrile |
|---|---|
| PubChem CID | 114694343 |
| Molecular Formula | C13H14ClN3 |
| Molecular Weight | 247.73 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | 2-chloro-6-(1,2,3,6-tetrahydropyridin-4-ylmethylamino)benzonitrile |
| SMILES | N#Cc1c(Cl)cccc1NCC1=CCNCC1 |
| InChI | InChI=1S/C13H14ClN3/c14-12-2-1-3-13(11(12)8-15)17-9-10-4-6-16-7-5-10/h1-4,16-17H,5-7,9H2 |
| InChIKey | LCPADPPAXRQTKN-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 47.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.73 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|