C10H13N7 — CID 114694406
N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)tetrazolo[1,5-a]pyrazin-5-amine (PubChem CID 114694406) has the molecular formula C10H13N7 and a molecular weight of 231.26 g/mol. Its IUPAC name is N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)tetrazolo[1,5-a]pyrazin-5-amine.
| Compound Name | N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)tetrazolo[1,5-a]pyrazin-5-amine |
|---|---|
| PubChem CID | 114694406 |
| Molecular Formula | C10H13N7 |
| Molecular Weight | 231.26 g/mol |
| Exact Mass | 231.12 |
| IUPAC Name | N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)tetrazolo[1,5-a]pyrazin-5-amine |
| SMILES | C1=C(CNc2cncc3nnnn23)CCNC1 |
| InChI | InChI=1S/C10H13N7/c1-3-11-4-2-8(1)5-13-9-6-12-7-10-14-15-16-17(9)10/h1,6-7,11,13H,2-5H2 |
| InChIKey | WCMZDORYMWPDJZ-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 80.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.26 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|