C11H16N4 — CID 114694552
3-methyl-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)pyrazin-2-amine (PubChem CID 114694552) has the molecular formula C11H16N4 and a molecular weight of 204.28 g/mol. Its IUPAC name is 3-methyl-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)pyrazin-2-amine.
| Compound Name | 3-methyl-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 114694552 |
| Molecular Formula | C11H16N4 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | 3-methyl-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)pyrazin-2-amine |
| SMILES | Cc1nccnc1NCC1=CCNCC1 |
| InChI | InChI=1S/C11H16N4/c1-9-11(14-7-6-13-9)15-8-10-2-4-12-5-3-10/h2,6-7,12H,3-5,8H2,1H3,(H,14,15) |
| InChIKey | NJTUORVXOPUVGE-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|