C15H21N5 — CID 114694557
5,6-diethyl-3-(1,2,3,6-tetrahydropyridin-4-ylmethylamino)pyridazine-4-carbonitrile (PubChem CID 114694557) has the molecular formula C15H21N5 and a molecular weight of 271.37 g/mol. Its IUPAC name is 5,6-diethyl-3-(1,2,3,6-tetrahydropyridin-4-ylmethylamino)pyridazine-4-carbonitrile.
| Compound Name | 5,6-diethyl-3-(1,2,3,6-tetrahydropyridin-4-ylmethylamino)pyridazine-4-carbonitrile |
|---|---|
| PubChem CID | 114694557 |
| Molecular Formula | C15H21N5 |
| Molecular Weight | 271.37 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | 5,6-diethyl-3-(1,2,3,6-tetrahydropyridin-4-ylmethylamino)pyridazine-4-carbonitrile |
| SMILES | CCc1nnc(NCC2=CCNCC2)c(C#N)c1CC |
| InChI | InChI=1S/C15H21N5/c1-3-12-13(9-16)15(20-19-14(12)4-2)18-10-11-5-7-17-8-6-11/h5,17H,3-4,6-8,10H2,1-2H3,(H,18,20) |
| InChIKey | KMPVRSJBNUYTFI-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.37 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|