C13H16O — CID 11469530
(1E,3R,4R)-4-methyl-1-phenylhexa-1,5-dien-3-ol (PubChem CID 11469530) has the molecular formula C13H16O and a molecular weight of 188.27 g/mol. Its IUPAC name is (1E,3R,4R)-4-methyl-1-phenylhexa-1,5-dien-3-ol.
| Compound Name | (1E,3R,4R)-4-methyl-1-phenylhexa-1,5-dien-3-ol |
|---|---|
| PubChem CID | 11469530 |
| Molecular Formula | C13H16O |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | (1E,3R,4R)-4-methyl-1-phenylhexa-1,5-dien-3-ol |
| SMILES | C=C[C@@H](C)[C@H](O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C13H16O/c1-3-11(2)13(14)10-9-12-7-5-4-6-8-12/h3-11,13-14H,1H2,2H3/b10-9+/t11-,13-/m1/s1 |
| InChIKey | BMMIGKFGBQCORF-SEDDIGHHSA-N |
| XLogP | 2.88 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|