About N-benzylhexan-2-imine
N-benzylhexan-2-imine (PubChem CID 11469543) has the molecular formula C13H19N
and a molecular weight of 189.30 g/mol. Its IUPAC name is N-benzylhexan-2-imine.
Molecular Properties
| Compound Name | N-benzylhexan-2-imine |
| PubChem CID | 11469543 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | N-benzylhexan-2-imine |
| SMILES | CCCC/C(C)=N/Cc1ccccc1 |
| InChI | InChI=1S/C13H19N/c1-3-4-8-12(2)14-11-13-9-6-5-7-10-13/h5-7,9-10H,3-4,8,11H2,1-2H3/b14-12+ |
| InChIKey | HUGWWKUBECAFGE-WYMLVPIESA-N |
| XLogP | 3.84 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-benzylhexan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzylhexan-2-imine?
The IUPAC name of N-benzylhexan-2-imine (CID 11469543) is N-benzylhexan-2-imine.
What is the SMILES notation for N-benzylhexan-2-imine?
The canonical SMILES for N-benzylhexan-2-imine is CCCC/C(C)=N/Cc1ccccc1.
What is the InChIKey of N-benzylhexan-2-imine?
The InChIKey is HUGWWKUBECAFGE-WYMLVPIESA-N. The full InChI is InChI=1S/C13H19N/c1-3-4-8-12(2)14-11-13-9-6-5-7-10-13/h5-7,9-10H,3-4,8,11H2,1-2H3/b14-12+.
What are the key properties of N-benzylhexan-2-imine?
N-benzylhexan-2-imine has a molecular weight of 189.30 g/mol, XLogP of 3.84, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzylhexan-2-imine is sourced from PubChem (CID 11469543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).