C12H18N4O3 — CID 114695495
6-methoxy-N-(2-methylpiperidin-3-yl)-3-nitropyridin-2-amine (PubChem CID 114695495) has the molecular formula C12H18N4O3 and a molecular weight of 266.30 g/mol. Its IUPAC name is 6-methoxy-N-(2-methylpiperidin-3-yl)-3-nitropyridin-2-amine.
| Compound Name | 6-methoxy-N-(2-methylpiperidin-3-yl)-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 114695495 |
| Molecular Formula | C12H18N4O3 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 6-methoxy-N-(2-methylpiperidin-3-yl)-3-nitropyridin-2-amine |
| SMILES | COc1ccc([N+](=O)[O-])c(NC2CCCNC2C)n1 |
| InChI | InChI=1S/C12H18N4O3/c1-8-9(4-3-7-13-8)14-12-10(16(17)18)5-6-11(15-12)19-2/h5-6,8-9,13H,3-4,7H2,1-2H3,(H,14,15) |
| InChIKey | WSPFJKXZJBINBR-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 89.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|