C12H19NO — CID 11469606
(2E,6Z)-N-cyclopropylnona-2,6-dienamide (PubChem CID 11469606) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is (2E,6Z)-N-cyclopropylnona-2,6-dienamide.
| Compound Name | (2E,6Z)-N-cyclopropylnona-2,6-dienamide |
|---|---|
| PubChem CID | 11469606 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | (2E,6Z)-N-cyclopropylnona-2,6-dienamide |
| SMILES | CC/C=C\CC/C=C/C(=O)NC1CC1 |
| InChI | InChI=1S/C12H19NO/c1-2-3-4-5-6-7-8-12(14)13-11-9-10-11/h3-4,7-8,11H,2,5-6,9-10H2,1H3,(H,13,14)/b4-3-,8-7+ |
| InChIKey | BTSTZWOTLKSKHV-ODYTWBPASA-N |
| XLogP | 2.57 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|