C12H18O2 — CID 11469616
(5R)-5-methyl-2-(oxan-2-yl)cyclohex-2-en-1-one (PubChem CID 11469616) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is (5R)-5-methyl-2-(oxan-2-yl)cyclohex-2-en-1-one.
| Compound Name | (5R)-5-methyl-2-(oxan-2-yl)cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 11469616 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | (5R)-5-methyl-2-(oxan-2-yl)cyclohex-2-en-1-one |
| SMILES | C[C@@H]1CC=C(C2CCCCO2)C(=O)C1 |
| InChI | InChI=1S/C12H18O2/c1-9-5-6-10(11(13)8-9)12-4-2-3-7-14-12/h6,9,12H,2-5,7-8H2,1H3/t9-,12?/m1/s1 |
| InChIKey | BPGKAMSBAOZHEM-PKEIRNPWSA-N |
| XLogP | 2.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |