About 2-[(1R)-4-methylcyclohex-3-en-1-yl]propan-2-yl acetate
2-[(1R)-4-methylcyclohex-3-en-1-yl]propan-2-yl acetate (PubChem CID 11469649) has the molecular formula C12H20O2
and a molecular weight of 196.29 g/mol. Its IUPAC name is 2-[(1R)-4-methylcyclohex-3-en-1-yl]propan-2-yl acetate.
Molecular Properties
| Compound Name | 2-[(1R)-4-methylcyclohex-3-en-1-yl]propan-2-yl acetate |
| PubChem CID | 11469649 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | 2-[(1R)-4-methylcyclohex-3-en-1-yl]propan-2-yl acetate |
| SMILES | CC(=O)OC(C)(C)[C@H]1CC=C(C)CC1 |
| InChI | InChI=1S/C12H20O2/c1-9-5-7-11(8-6-9)12(3,4)14-10(2)13/h5,11H,6-8H2,1-4H3/t11-/m0/s1 |
| InChIKey | IGODOXYLBBXFDW-NSHDSACASA-N |
| XLogP | 3.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1R)-4-methylcyclohex-3-en-1-yl]propan-2-yl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1R)-4-methylcyclohex-3-en-1-yl]propan-2-yl acetate?
The IUPAC name of 2-[(1R)-4-methylcyclohex-3-en-1-yl]propan-2-yl acetate (CID 11469649) is 2-[(1R)-4-methylcyclohex-3-en-1-yl]propan-2-yl acetate.
What is the SMILES notation for 2-[(1R)-4-methylcyclohex-3-en-1-yl]propan-2-yl acetate?
The canonical SMILES for 2-[(1R)-4-methylcyclohex-3-en-1-yl]propan-2-yl acetate is CC(=O)OC(C)(C)[C@H]1CC=C(C)CC1.
What is the InChIKey of 2-[(1R)-4-methylcyclohex-3-en-1-yl]propan-2-yl acetate?
The InChIKey is IGODOXYLBBXFDW-NSHDSACASA-N. The full InChI is InChI=1S/C12H20O2/c1-9-5-7-11(8-6-9)12(3,4)14-10(2)13/h5,11H,6-8H2,1-4H3/t11-/m0/s1.
What are the key properties of 2-[(1R)-4-methylcyclohex-3-en-1-yl]propan-2-yl acetate?
2-[(1R)-4-methylcyclohex-3-en-1-yl]propan-2-yl acetate has a molecular weight of 196.29 g/mol, XLogP of 3.07, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1R)-4-methylcyclohex-3-en-1-yl]propan-2-yl acetate is sourced from PubChem (CID 11469649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).