C13H20O2 — CID 11469848
(1R,5R,6R,8S)-8-methoxy-2-methyl-5-propan-2-ylbicyclo[4.2.0]oct-2-en-7-one (PubChem CID 11469848) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is (1R,5R,6R,8S)-8-methoxy-2-methyl-5-propan-2-ylbicyclo[4.2.0]oct-2-en-7-one.
| Compound Name | (1R,5R,6R,8S)-8-methoxy-2-methyl-5-propan-2-ylbicyclo[4.2.0]oct-2-en-7-one |
|---|---|
| PubChem CID | 11469848 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | (1R,5R,6R,8S)-8-methoxy-2-methyl-5-propan-2-ylbicyclo[4.2.0]oct-2-en-7-one |
| SMILES | CO[C@@H]1C(=O)[C@H]2[C@@H]1C(C)=CC[C@@H]2C(C)C |
| InChI | InChI=1S/C13H20O2/c1-7(2)9-6-5-8(3)10-11(9)12(14)13(10)15-4/h5,7,9-11,13H,6H2,1-4H3/t9-,10+,11-,13+/m1/s1 |
| InChIKey | GOWAFHKHNQJCPK-XZUYRWCXSA-N |
| XLogP | 2.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|