About ethyl 2-[(2R,4R)-4-hydroxypyrrolidin-2-yl]acetate;hydrochloride
ethyl 2-[(2R,4R)-4-hydroxypyrrolidin-2-yl]acetate;hydrochloride (PubChem CID 11469867) has the molecular formula C8H16ClNO3
and a molecular weight of 209.67 g/mol. Its IUPAC name is ethyl 2-[(2R,4R)-4-hydroxypyrrolidin-2-yl]acetate;hydrochloride.
Molecular Properties
| Compound Name | ethyl 2-[(2R,4R)-4-hydroxypyrrolidin-2-yl]acetate;hydrochloride |
| PubChem CID | 11469867 |
| Molecular Formula | C8H16ClNO3 |
| Molecular Weight | 209.67 g/mol |
| Exact Mass | 209.08 |
| IUPAC Name | ethyl 2-[(2R,4R)-4-hydroxypyrrolidin-2-yl]acetate;hydrochloride |
| SMILES | CCOC(=O)C[C@H]1C[C@@H](O)CN1.Cl |
| InChI | InChI=1S/C8H15NO3.ClH/c1-2-12-8(11)4-6-3-7(10)5-9-6;/h6-7,9-10H,2-5H2,1H3;1H/t6-,7-;/m1./s1 |
| InChIKey | CWZCENZSCUSKAQ-ZJLYAJKPSA-N |
| XLogP | 0.08 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.67 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 2-[(2R,4R)-4-hydroxypyrrolidin-2-yl]acetate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(2R,4R)-4-hydroxypyrrolidin-2-yl]acetate;hydrochloride?
The IUPAC name of ethyl 2-[(2R,4R)-4-hydroxypyrrolidin-2-yl]acetate;hydrochloride (CID 11469867) is ethyl 2-[(2R,4R)-4-hydroxypyrrolidin-2-yl]acetate;hydrochloride.
What is the SMILES notation for ethyl 2-[(2R,4R)-4-hydroxypyrrolidin-2-yl]acetate;hydrochloride?
The canonical SMILES for ethyl 2-[(2R,4R)-4-hydroxypyrrolidin-2-yl]acetate;hydrochloride is CCOC(=O)C[C@H]1C[C@@H](O)CN1.Cl.
What is the InChIKey of ethyl 2-[(2R,4R)-4-hydroxypyrrolidin-2-yl]acetate;hydrochloride?
The InChIKey is CWZCENZSCUSKAQ-ZJLYAJKPSA-N. The full InChI is InChI=1S/C8H15NO3.ClH/c1-2-12-8(11)4-6-3-7(10)5-9-6;/h6-7,9-10H,2-5H2,1H3;1H/t6-,7-;/m1./s1.
What are the key properties of ethyl 2-[(2R,4R)-4-hydroxypyrrolidin-2-yl]acetate;hydrochloride?
ethyl 2-[(2R,4R)-4-hydroxypyrrolidin-2-yl]acetate;hydrochloride has a molecular weight of 209.67 g/mol, XLogP of 0.08, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(2R,4R)-4-hydroxypyrrolidin-2-yl]acetate;hydrochloride is sourced from PubChem (CID 11469867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).