About trimethylsulfanium
trimethylsulfanium (PubChem CID 1147) has the molecular formula C3H9S+
and a molecular weight of 77.17 g/mol. Its IUPAC name is trimethylsulfanium.
Molecular Properties
| Compound Name | trimethylsulfanium |
| PubChem CID | 1147 |
| Molecular Formula | C3H9S+ |
| Molecular Weight | 77.17 g/mol |
| Exact Mass | 77.04 |
| IUPAC Name | trimethylsulfanium |
| SMILES | C[S+](C)C |
| InChI | InChI=1S/C3H9S/c1-4(2)3/h1-3H3/q+1 |
| InChIKey | NRZWQKGABZFFKE-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 4 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 77.17 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze trimethylsulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethylsulfanium?
The IUPAC name of trimethylsulfanium (CID 1147) is trimethylsulfanium.
What is the SMILES notation for trimethylsulfanium?
The canonical SMILES for trimethylsulfanium is C[S+](C)C.
What is the InChIKey of trimethylsulfanium?
The InChIKey is NRZWQKGABZFFKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9S/c1-4(2)3/h1-3H3/q+1.
What are the key properties of trimethylsulfanium?
trimethylsulfanium has a molecular weight of 77.17 g/mol, XLogP of 0.49, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trimethylsulfanium is sourced from PubChem (CID 1147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).