About 1-ethylpyridin-1-ium;2,2,2-trifluoroacetate
1-ethylpyridin-1-ium;2,2,2-trifluoroacetate (PubChem CID 11470068) has the molecular formula C9H10F3NO2
and a molecular weight of 221.18 g/mol. Its IUPAC name is 1-ethylpyridin-1-ium;2,2,2-trifluoroacetate.
Molecular Properties
| Compound Name | 1-ethylpyridin-1-ium;2,2,2-trifluoroacetate |
| PubChem CID | 11470068 |
| Molecular Formula | C9H10F3NO2 |
| Molecular Weight | 221.18 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 1-ethylpyridin-1-ium;2,2,2-trifluoroacetate |
| SMILES | CC[n+]1ccccc1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C7H10N.C2HF3O2/c1-2-8-6-4-3-5-7-8;3-2(4,5)1(6)7/h3-7H,2H2,1H3;(H,6,7)/q+1;/p-1 |
| InChIKey | KRZJGQOCEVNBKP-UHFFFAOYSA-M |
| XLogP | 0.29 |
| TPSA | 44.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.18 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-ethylpyridin-1-ium;2,2,2-trifluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethylpyridin-1-ium;2,2,2-trifluoroacetate?
The IUPAC name of 1-ethylpyridin-1-ium;2,2,2-trifluoroacetate (CID 11470068) is 1-ethylpyridin-1-ium;2,2,2-trifluoroacetate.
What is the SMILES notation for 1-ethylpyridin-1-ium;2,2,2-trifluoroacetate?
The canonical SMILES for 1-ethylpyridin-1-ium;2,2,2-trifluoroacetate is CC[n+]1ccccc1.O=C([O-])C(F)(F)F.
What is the InChIKey of 1-ethylpyridin-1-ium;2,2,2-trifluoroacetate?
The InChIKey is KRZJGQOCEVNBKP-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H10N.C2HF3O2/c1-2-8-6-4-3-5-7-8;3-2(4,5)1(6)7/h3-7H,2H2,1H3;(H,6,7)/q+1;/p-1.
What are the key properties of 1-ethylpyridin-1-ium;2,2,2-trifluoroacetate?
1-ethylpyridin-1-ium;2,2,2-trifluoroacetate has a molecular weight of 221.18 g/mol, XLogP of 0.29, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethylpyridin-1-ium;2,2,2-trifluoroacetate is sourced from PubChem (CID 11470068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).