C15H13Cl2N3 — CID 114701318
6-chloro-2-(chloromethyl)-1-[(3-methyl-4-pyridinyl)methyl]benzimidazole (PubChem CID 114701318) has the molecular formula C15H13Cl2N3 and a molecular weight of 306.20 g/mol. Its IUPAC name is 6-chloro-2-(chloromethyl)-1-[(3-methyl-4-pyridinyl)methyl]benzimidazole.
| Compound Name | 6-chloro-2-(chloromethyl)-1-[(3-methyl-4-pyridinyl)methyl]benzimidazole |
|---|---|
| PubChem CID | 114701318 |
| Molecular Formula | C15H13Cl2N3 |
| Molecular Weight | 306.20 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 6-chloro-2-(chloromethyl)-1-[(3-methyl-4-pyridinyl)methyl]benzimidazole |
| SMILES | Cc1cnccc1Cn1c(CCl)nc2ccc(Cl)cc21 |
| InChI | InChI=1S/C15H13Cl2N3/c1-10-8-18-5-4-11(10)9-20-14-6-12(17)2-3-13(14)19-15(20)7-16/h2-6,8H,7,9H2,1H3 |
| InChIKey | LXSFKJHAUARRPD-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.20 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|