C10H18O6 — CID 11470333
(1S,2S,3S,4S,5R,6R)-5-methoxy-6-prop-2-enoxycyclohexane-1,2,3,4-tetrol (PubChem CID 11470333) has the molecular formula C10H18O6 and a molecular weight of 234.25 g/mol. Its IUPAC name is (1S,2S,3S,4S,5R,6R)-5-methoxy-6-prop-2-enoxycyclohexane-1,2,3,4-tetrol.
| Compound Name | (1S,2S,3S,4S,5R,6R)-5-methoxy-6-prop-2-enoxycyclohexane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 11470333 |
| Molecular Formula | C10H18O6 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | (1S,2S,3S,4S,5R,6R)-5-methoxy-6-prop-2-enoxycyclohexane-1,2,3,4-tetrol |
| SMILES | C=CCO[C@@H]1[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)[C@H]1OC |
| InChI | InChI=1S/C10H18O6/c1-3-4-16-10-8(14)6(12)5(11)7(13)9(10)15-2/h3,5-14H,1,4H2,2H3/t5-,6-,7-,8-,9+,10+/m0/s1 |
| InChIKey | ZJFGNUOHUSWLNB-KZZCMQFTSA-N |
| XLogP | -1.97 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|