C13H21N3O2 — CID 114704448
3-[3-(1,4-dioxan-2-ylmethyl)imidazol-4-yl]piperidine (PubChem CID 114704448) has the molecular formula C13H21N3O2 and a molecular weight of 251.33 g/mol. Its IUPAC name is 3-[3-(1,4-dioxan-2-ylmethyl)imidazol-4-yl]piperidine.
| Compound Name | 3-[3-(1,4-dioxan-2-ylmethyl)imidazol-4-yl]piperidine |
|---|---|
| PubChem CID | 114704448 |
| Molecular Formula | C13H21N3O2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | 3-[3-(1,4-dioxan-2-ylmethyl)imidazol-4-yl]piperidine |
| SMILES | c1ncn(CC2COCCO2)c1C1CCCNC1 |
| InChI | InChI=1S/C13H21N3O2/c1-2-11(6-14-3-1)13-7-15-10-16(13)8-12-9-17-4-5-18-12/h7,10-12,14H,1-6,8-9H2 |
| InChIKey | WMULUIGKDNUVCY-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |