C7H13NO6S — CID 11470464
(4S,4aS,5S,6R)-1,1-dioxo-4,4a,5,6,7,8-hexahydro-3H-pyrido[1,2-c]oxathiazine-4,5,6-triol (PubChem CID 11470464) has the molecular formula C7H13NO6S and a molecular weight of 239.25 g/mol. Its IUPAC name is (4S,4aS,5S,6R)-1,1-dioxo-4,4a,5,6,7,8-hexahydro-3H-pyrido[1,2-c]oxathiazine-4,5,6-triol.
| Compound Name | (4S,4aS,5S,6R)-1,1-dioxo-4,4a,5,6,7,8-hexahydro-3H-pyrido[1,2-c]oxathiazine-4,5,6-triol |
|---|---|
| PubChem CID | 11470464 |
| Molecular Formula | C7H13NO6S |
| Molecular Weight | 239.25 g/mol |
| Exact Mass | 239.05 |
| IUPAC Name | (4S,4aS,5S,6R)-1,1-dioxo-4,4a,5,6,7,8-hexahydro-3H-pyrido[1,2-c]oxathiazine-4,5,6-triol |
| SMILES | O=S1(=O)OC[C@@H](O)[C@H]2[C@H](O)[C@H](O)CCN21 |
| InChI | InChI=1S/C7H13NO6S/c9-4-1-2-8-6(7(4)11)5(10)3-14-15(8,12)13/h4-7,9-11H,1-3H2/t4-,5-,6+,7-/m1/s1 |
| InChIKey | QZDTZLSAGSEJGH-MVIOUDGNSA-N |
| XLogP | -2.58 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.25 |
| LogP ≤ 5 | -2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |