C10H18N4O — CID 114704961
2-amino-2-[3-(1-methylpyrrolidin-3-yl)imidazol-4-yl]ethanol (PubChem CID 114704961) has the molecular formula C10H18N4O and a molecular weight of 210.28 g/mol. Its IUPAC name is 2-amino-2-[3-(1-methylpyrrolidin-3-yl)imidazol-4-yl]ethanol.
| Compound Name | 2-amino-2-[3-(1-methylpyrrolidin-3-yl)imidazol-4-yl]ethanol |
|---|---|
| PubChem CID | 114704961 |
| Molecular Formula | C10H18N4O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | 2-amino-2-[3-(1-methylpyrrolidin-3-yl)imidazol-4-yl]ethanol |
| SMILES | CN1CCC(n2cncc2C(N)CO)C1 |
| InChI | InChI=1S/C10H18N4O/c1-13-3-2-8(5-13)14-7-12-4-10(14)9(11)6-15/h4,7-9,15H,2-3,5-6,11H2,1H3 |
| InChIKey | ZATSLGVWUSTOKR-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |