C13H14F3N3O — CID 114705699
2-amino-2-[3-[[4-(trifluoromethyl)phenyl]methyl]imidazol-4-yl]ethanol (PubChem CID 114705699) has the molecular formula C13H14F3N3O and a molecular weight of 285.27 g/mol. Its IUPAC name is 2-amino-2-[3-[[4-(trifluoromethyl)phenyl]methyl]imidazol-4-yl]ethanol.
| Compound Name | 2-amino-2-[3-[[4-(trifluoromethyl)phenyl]methyl]imidazol-4-yl]ethanol |
|---|---|
| PubChem CID | 114705699 |
| Molecular Formula | C13H14F3N3O |
| Molecular Weight | 285.27 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 2-amino-2-[3-[[4-(trifluoromethyl)phenyl]methyl]imidazol-4-yl]ethanol |
| SMILES | NC(CO)c1cncn1Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H14F3N3O/c14-13(15,16)10-3-1-9(2-4-10)6-19-8-18-5-12(19)11(17)7-20/h1-5,8,11,20H,6-7,17H2 |
| InChIKey | RQVDBMHPGFNTQK-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.27 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |