C17H21N3O — CID 114705795
3-[3-(3,4-dihydro-2H-chromen-4-yl)imidazol-4-yl]piperidine (PubChem CID 114705795) has the molecular formula C17H21N3O and a molecular weight of 283.37 g/mol. Its IUPAC name is 3-[3-(3,4-dihydro-2H-chromen-4-yl)imidazol-4-yl]piperidine.
| Compound Name | 3-[3-(3,4-dihydro-2H-chromen-4-yl)imidazol-4-yl]piperidine |
|---|---|
| PubChem CID | 114705795 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 3-[3-(3,4-dihydro-2H-chromen-4-yl)imidazol-4-yl]piperidine |
| SMILES | c1ccc2c(c1)OCCC2n1cncc1C1CCCNC1 |
| InChI | InChI=1S/C17H21N3O/c1-2-6-17-14(5-1)15(7-9-21-17)20-12-19-11-16(20)13-4-3-8-18-10-13/h1-2,5-6,11-13,15,18H,3-4,7-10H2 |
| InChIKey | NVAZIBJROROALF-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |