C11H14N4O — CID 114705991
2-amino-2-[3-(4-methyl-3-pyridinyl)imidazol-4-yl]ethanol (PubChem CID 114705991) has the molecular formula C11H14N4O and a molecular weight of 218.26 g/mol. Its IUPAC name is 2-amino-2-[3-(4-methyl-3-pyridinyl)imidazol-4-yl]ethanol.
| Compound Name | 2-amino-2-[3-(4-methyl-3-pyridinyl)imidazol-4-yl]ethanol |
|---|---|
| PubChem CID | 114705991 |
| Molecular Formula | C11H14N4O |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 2-amino-2-[3-(4-methyl-3-pyridinyl)imidazol-4-yl]ethanol |
| SMILES | Cc1ccncc1-n1cncc1C(N)CO |
| InChI | InChI=1S/C11H14N4O/c1-8-2-3-13-4-10(8)15-7-14-5-11(15)9(12)6-16/h2-5,7,9,16H,6,12H2,1H3 |
| InChIKey | VIBITKMDNTUVQG-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |