About [(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl] 3-aminobenzoate
[(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl] 3-aminobenzoate (PubChem CID 11470630) has the molecular formula C14H18N2O2
and a molecular weight of 246.31 g/mol. Its IUPAC name is [(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl] 3-aminobenzoate.
Molecular Properties
| Compound Name | [(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl] 3-aminobenzoate |
| PubChem CID | 11470630 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | [(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl] 3-aminobenzoate |
| SMILES | Nc1cccc(C(=O)OC2C[C@H]3CC[C@@H](C2)N3)c1 |
| InChI | InChI=1S/C14H18N2O2/c15-10-3-1-2-9(6-10)14(17)18-13-7-11-4-5-12(8-13)16-11/h1-3,6,11-13,16H,4-5,7-8,15H2/t11-,12+,13? |
| InChIKey | ADQITCGLUXPSGD-FUNVUKJBSA-N |
| XLogP | 1.71 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze [(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl] 3-aminobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl] 3-aminobenzoate?
The IUPAC name of [(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl] 3-aminobenzoate (CID 11470630) is [(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl] 3-aminobenzoate.
What is the SMILES notation for [(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl] 3-aminobenzoate?
The canonical SMILES for [(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl] 3-aminobenzoate is Nc1cccc(C(=O)OC2C[C@H]3CC[C@@H](C2)N3)c1.
What is the InChIKey of [(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl] 3-aminobenzoate?
The InChIKey is ADQITCGLUXPSGD-FUNVUKJBSA-N. The full InChI is InChI=1S/C14H18N2O2/c15-10-3-1-2-9(6-10)14(17)18-13-7-11-4-5-12(8-13)16-11/h1-3,6,11-13,16H,4-5,7-8,15H2/t11-,12+,13?.
What are the key properties of [(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl] 3-aminobenzoate?
[(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl] 3-aminobenzoate has a molecular weight of 246.31 g/mol, XLogP of 1.71, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl] 3-aminobenzoate is sourced from PubChem (CID 11470630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).