About 2-[5-(1-amino-3-methylbutyl)imidazol-1-yl]-N,N-diethylpropanamide
2-[5-(1-amino-3-methylbutyl)imidazol-1-yl]-N,N-diethylpropanamide (PubChem CID 114707141) has the molecular formula C15H28N4O
and a molecular weight of 280.42 g/mol. Its IUPAC name is 2-[5-(1-amino-3-methylbutyl)imidazol-1-yl]-N,N-diethylpropanamide.
Molecular Properties
| Compound Name | 2-[5-(1-amino-3-methylbutyl)imidazol-1-yl]-N,N-diethylpropanamide |
| PubChem CID | 114707141 |
| Molecular Formula | C15H28N4O |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.23 |
| IUPAC Name | 2-[5-(1-amino-3-methylbutyl)imidazol-1-yl]-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)C(C)n1cncc1C(N)CC(C)C |
| InChI | InChI=1S/C15H28N4O/c1-6-18(7-2)15(20)12(5)19-10-17-9-14(19)13(16)8-11(3)4/h9-13H,6-8,16H2,1-5H3 |
| InChIKey | TWRYFNCDNKMWFA-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[5-(1-amino-3-methylbutyl)imidazol-1-yl]-N,N-diethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(1-amino-3-methylbutyl)imidazol-1-yl]-N,N-diethylpropanamide?
The IUPAC name of 2-[5-(1-amino-3-methylbutyl)imidazol-1-yl]-N,N-diethylpropanamide (CID 114707141) is 2-[5-(1-amino-3-methylbutyl)imidazol-1-yl]-N,N-diethylpropanamide.
What is the SMILES notation for 2-[5-(1-amino-3-methylbutyl)imidazol-1-yl]-N,N-diethylpropanamide?
The canonical SMILES for 2-[5-(1-amino-3-methylbutyl)imidazol-1-yl]-N,N-diethylpropanamide is CCN(CC)C(=O)C(C)n1cncc1C(N)CC(C)C.
What is the InChIKey of 2-[5-(1-amino-3-methylbutyl)imidazol-1-yl]-N,N-diethylpropanamide?
The InChIKey is TWRYFNCDNKMWFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28N4O/c1-6-18(7-2)15(20)12(5)19-10-17-9-14(19)13(16)8-11(3)4/h9-13H,6-8,16H2,1-5H3.
What are the key properties of 2-[5-(1-amino-3-methylbutyl)imidazol-1-yl]-N,N-diethylpropanamide?
2-[5-(1-amino-3-methylbutyl)imidazol-1-yl]-N,N-diethylpropanamide has a molecular weight of 280.42 g/mol, XLogP of 2.36, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(1-amino-3-methylbutyl)imidazol-1-yl]-N,N-diethylpropanamide is sourced from PubChem (CID 114707141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).