C15H25NO2 — CID 11470739
(1R,3S,4S,5S,8S,11R)-5-ethenyl-7,7,11-trimethyl-2-oxa-6-azatricyclo[6.4.0.03,6]dodecan-4-ol (PubChem CID 11470739) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is (1R,3S,4S,5S,8S,11R)-5-ethenyl-7,7,11-trimethyl-2-oxa-6-azatricyclo[6.4.0.03,6]dodecan-4-ol.
| Compound Name | (1R,3S,4S,5S,8S,11R)-5-ethenyl-7,7,11-trimethyl-2-oxa-6-azatricyclo[6.4.0.03,6]dodecan-4-ol |
|---|---|
| PubChem CID | 11470739 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | (1R,3S,4S,5S,8S,11R)-5-ethenyl-7,7,11-trimethyl-2-oxa-6-azatricyclo[6.4.0.03,6]dodecan-4-ol |
| SMILES | C=C[C@H]1[C@H](O)[C@@H]2O[C@@H]3C[C@H](C)CC[C@H]3C(C)(C)N12 |
| InChI | InChI=1S/C15H25NO2/c1-5-11-13(17)14-16(11)15(3,4)10-7-6-9(2)8-12(10)18-14/h5,9-14,17H,1,6-8H2,2-4H3/t9-,10-,11+,12-,13+,14+/m1/s1 |
| InChIKey | LBXLHLUYVQRFMH-PRFQISJJSA-N |
| XLogP | 2.16 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|