C16H27N3O2 — CID 114707734
tert-butyl N-[1-[3-(3-methylcyclopentyl)imidazol-4-yl]ethyl]carbamate (PubChem CID 114707734) has the molecular formula C16H27N3O2 and a molecular weight of 293.41 g/mol. Its IUPAC name is tert-butyl N-[1-[3-(3-methylcyclopentyl)imidazol-4-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[1-[3-(3-methylcyclopentyl)imidazol-4-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 114707734 |
| Molecular Formula | C16H27N3O2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | tert-butyl N-[1-[3-(3-methylcyclopentyl)imidazol-4-yl]ethyl]carbamate |
| SMILES | CC1CCC(n2cncc2C(C)NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C16H27N3O2/c1-11-6-7-13(8-11)19-10-17-9-14(19)12(2)18-15(20)21-16(3,4)5/h9-13H,6-8H2,1-5H3,(H,18,20) |
| InChIKey | PKMQOKLPWSRYDF-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |