C13H26N4O — CID 114708261
2-[3-[2-[2-methoxyethyl(methyl)amino]ethyl]imidazol-4-yl]-N-methylpropan-2-amine (PubChem CID 114708261) has the molecular formula C13H26N4O and a molecular weight of 254.38 g/mol. Its IUPAC name is 2-[3-[2-[2-methoxyethyl(methyl)amino]ethyl]imidazol-4-yl]-N-methylpropan-2-amine.
| Compound Name | 2-[3-[2-[2-methoxyethyl(methyl)amino]ethyl]imidazol-4-yl]-N-methylpropan-2-amine |
|---|---|
| PubChem CID | 114708261 |
| Molecular Formula | C13H26N4O |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.21 |
| IUPAC Name | 2-[3-[2-[2-methoxyethyl(methyl)amino]ethyl]imidazol-4-yl]-N-methylpropan-2-amine |
| SMILES | CNC(C)(C)c1cncn1CCN(C)CCOC |
| InChI | InChI=1S/C13H26N4O/c1-13(2,14-3)12-10-15-11-17(12)7-6-16(4)8-9-18-5/h10-11,14H,6-9H2,1-5H3 |
| InChIKey | ZAOAWBFHWSIICX-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |