C12H21N3OS — CID 114708440
N-methyl-2-[3-(1-oxothian-4-yl)imidazol-4-yl]propan-2-amine (PubChem CID 114708440) has the molecular formula C12H21N3OS and a molecular weight of 255.39 g/mol. Its IUPAC name is N-methyl-2-[3-(1-oxothian-4-yl)imidazol-4-yl]propan-2-amine.
| Compound Name | N-methyl-2-[3-(1-oxothian-4-yl)imidazol-4-yl]propan-2-amine |
|---|---|
| PubChem CID | 114708440 |
| Molecular Formula | C12H21N3OS |
| Molecular Weight | 255.39 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | N-methyl-2-[3-(1-oxothian-4-yl)imidazol-4-yl]propan-2-amine |
| SMILES | CNC(C)(C)c1cncn1C1CCS(=O)CC1 |
| InChI | InChI=1S/C12H21N3OS/c1-12(2,13-3)11-8-14-9-15(11)10-4-6-17(16)7-5-10/h8-10,13H,4-7H2,1-3H3 |
| InChIKey | MMXHOGHXWSWOQJ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.39 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |