C15H12BrClFNO — CID 114708908
2-(3-bromo-4-fluorophenyl)-6-chloro-3,4-dihydro-2H-chromen-4-amine (PubChem CID 114708908) has the molecular formula C15H12BrClFNO and a molecular weight of 356.62 g/mol. Its IUPAC name is 2-(3-bromo-4-fluorophenyl)-6-chloro-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | 2-(3-bromo-4-fluorophenyl)-6-chloro-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 114708908 |
| Molecular Formula | C15H12BrClFNO |
| Molecular Weight | 356.62 g/mol |
| Exact Mass | 354.98 |
| IUPAC Name | 2-(3-bromo-4-fluorophenyl)-6-chloro-3,4-dihydro-2H-chromen-4-amine |
| SMILES | NC1CC(c2ccc(F)c(Br)c2)Oc2ccc(Cl)cc21 |
| InChI | InChI=1S/C15H12BrClFNO/c16-11-5-8(1-3-12(11)18)15-7-13(19)10-6-9(17)2-4-14(10)20-15/h1-6,13,15H,7,19H2 |
| InChIKey | XREIGIACRQLXDK-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.62 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |