About 1'-ethyl-6-methylspiro[3,4-dihydrochromene-2,4'-azepane]-4-amine
1'-ethyl-6-methylspiro[3,4-dihydrochromene-2,4'-azepane]-4-amine (PubChem CID 114709709) has the molecular formula C17H26N2O
and a molecular weight of 274.41 g/mol. Its IUPAC name is 1'-ethyl-6-methylspiro[3,4-dihydrochromene-2,4'-azepane]-4-amine.
Molecular Properties
| Compound Name | 1'-ethyl-6-methylspiro[3,4-dihydrochromene-2,4'-azepane]-4-amine |
| PubChem CID | 114709709 |
| Molecular Formula | C17H26N2O |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | 1'-ethyl-6-methylspiro[3,4-dihydrochromene-2,4'-azepane]-4-amine |
| SMILES | CCN1CCCC2(CC1)CC(N)c1cc(C)ccc1O2 |
| InChI | InChI=1S/C17H26N2O/c1-3-19-9-4-7-17(8-10-19)12-15(18)14-11-13(2)5-6-16(14)20-17/h5-6,11,15H,3-4,7-10,12,18H2,1-2H3 |
| InChIKey | RPCMFNFLUCFDNZ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1'-ethyl-6-methylspiro[3,4-dihydrochromene-2,4'-azepane]-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-ethyl-6-methylspiro[3,4-dihydrochromene-2,4'-azepane]-4-amine?
The IUPAC name of 1'-ethyl-6-methylspiro[3,4-dihydrochromene-2,4'-azepane]-4-amine (CID 114709709) is 1'-ethyl-6-methylspiro[3,4-dihydrochromene-2,4'-azepane]-4-amine.
What is the SMILES notation for 1'-ethyl-6-methylspiro[3,4-dihydrochromene-2,4'-azepane]-4-amine?
The canonical SMILES for 1'-ethyl-6-methylspiro[3,4-dihydrochromene-2,4'-azepane]-4-amine is CCN1CCCC2(CC1)CC(N)c1cc(C)ccc1O2.
What is the InChIKey of 1'-ethyl-6-methylspiro[3,4-dihydrochromene-2,4'-azepane]-4-amine?
The InChIKey is RPCMFNFLUCFDNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N2O/c1-3-19-9-4-7-17(8-10-19)12-15(18)14-11-13(2)5-6-16(14)20-17/h5-6,11,15H,3-4,7-10,12,18H2,1-2H3.
What are the key properties of 1'-ethyl-6-methylspiro[3,4-dihydrochromene-2,4'-azepane]-4-amine?
1'-ethyl-6-methylspiro[3,4-dihydrochromene-2,4'-azepane]-4-amine has a molecular weight of 274.41 g/mol, XLogP of 3.02, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-ethyl-6-methylspiro[3,4-dihydrochromene-2,4'-azepane]-4-amine is sourced from PubChem (CID 114709709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).