About [(E)-(3,4-difluorophenyl)methylideneamino] benzoate
[(E)-(3,4-difluorophenyl)methylideneamino] benzoate (PubChem CID 11470979) has the molecular formula C14H9F2NO2
and a molecular weight of 261.23 g/mol. Its IUPAC name is [(E)-(3,4-difluorophenyl)methylideneamino] benzoate.
Molecular Properties
| Compound Name | [(E)-(3,4-difluorophenyl)methylideneamino] benzoate |
| PubChem CID | 11470979 |
| Molecular Formula | C14H9F2NO2 |
| Molecular Weight | 261.23 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | [(E)-(3,4-difluorophenyl)methylideneamino] benzoate |
| SMILES | O=C(O/N=C/c1ccc(F)c(F)c1)c1ccccc1 |
| InChI | InChI=1S/C14H9F2NO2/c15-12-7-6-10(8-13(12)16)9-17-19-14(18)11-4-2-1-3-5-11/h1-9H/b17-9+ |
| InChIKey | HOHACQRGFZUDCD-RQZCQDPDSA-N |
| XLogP | 3.16 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.23 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-(3,4-difluorophenyl)methylideneamino] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-(3,4-difluorophenyl)methylideneamino] benzoate?
The IUPAC name of [(E)-(3,4-difluorophenyl)methylideneamino] benzoate (CID 11470979) is [(E)-(3,4-difluorophenyl)methylideneamino] benzoate.
What is the SMILES notation for [(E)-(3,4-difluorophenyl)methylideneamino] benzoate?
The canonical SMILES for [(E)-(3,4-difluorophenyl)methylideneamino] benzoate is O=C(O/N=C/c1ccc(F)c(F)c1)c1ccccc1.
What is the InChIKey of [(E)-(3,4-difluorophenyl)methylideneamino] benzoate?
The InChIKey is HOHACQRGFZUDCD-RQZCQDPDSA-N. The full InChI is InChI=1S/C14H9F2NO2/c15-12-7-6-10(8-13(12)16)9-17-19-14(18)11-4-2-1-3-5-11/h1-9H/b17-9+.
What are the key properties of [(E)-(3,4-difluorophenyl)methylideneamino] benzoate?
[(E)-(3,4-difluorophenyl)methylideneamino] benzoate has a molecular weight of 261.23 g/mol, XLogP of 3.16, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-(3,4-difluorophenyl)methylideneamino] benzoate is sourced from PubChem (CID 11470979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).