C14H18BrNO2 — CID 114709987
6-bromo-2-(oxan-4-yl)-3,4-dihydro-2H-chromen-4-amine (PubChem CID 114709987) has the molecular formula C14H18BrNO2 and a molecular weight of 312.21 g/mol. Its IUPAC name is 6-bromo-2-(oxan-4-yl)-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | 6-bromo-2-(oxan-4-yl)-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 114709987 |
| Molecular Formula | C14H18BrNO2 |
| Molecular Weight | 312.21 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | 6-bromo-2-(oxan-4-yl)-3,4-dihydro-2H-chromen-4-amine |
| SMILES | NC1CC(C2CCOCC2)Oc2ccc(Br)cc21 |
| InChI | InChI=1S/C14H18BrNO2/c15-10-1-2-13-11(7-10)12(16)8-14(18-13)9-3-5-17-6-4-9/h1-2,7,9,12,14H,3-6,8,16H2 |
| InChIKey | WTHJUOPHOMTKFE-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.21 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |