About 6-bromo-1'-propylspiro[3,4-dihydrochromene-2,4'-azepane]-4-amine
6-bromo-1'-propylspiro[3,4-dihydrochromene-2,4'-azepane]-4-amine (PubChem CID 114710193) has the molecular formula C17H25BrN2O
and a molecular weight of 353.30 g/mol. Its IUPAC name is 6-bromo-1'-propylspiro[3,4-dihydrochromene-2,4'-azepane]-4-amine.
Molecular Properties
| Compound Name | 6-bromo-1'-propylspiro[3,4-dihydrochromene-2,4'-azepane]-4-amine |
| PubChem CID | 114710193 |
| Molecular Formula | C17H25BrN2O |
| Molecular Weight | 353.30 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 6-bromo-1'-propylspiro[3,4-dihydrochromene-2,4'-azepane]-4-amine |
| SMILES | CCCN1CCCC2(CC1)CC(N)c1cc(Br)ccc1O2 |
| InChI | InChI=1S/C17H25BrN2O/c1-2-8-20-9-3-6-17(7-10-20)12-15(19)14-11-13(18)4-5-16(14)21-17/h4-5,11,15H,2-3,6-10,12,19H2,1H3 |
| InChIKey | YOFTVRXODDBWQP-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.30 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-bromo-1'-propylspiro[3,4-dihydrochromene-2,4'-azepane]-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-1'-propylspiro[3,4-dihydrochromene-2,4'-azepane]-4-amine?
The IUPAC name of 6-bromo-1'-propylspiro[3,4-dihydrochromene-2,4'-azepane]-4-amine (CID 114710193) is 6-bromo-1'-propylspiro[3,4-dihydrochromene-2,4'-azepane]-4-amine.
What is the SMILES notation for 6-bromo-1'-propylspiro[3,4-dihydrochromene-2,4'-azepane]-4-amine?
The canonical SMILES for 6-bromo-1'-propylspiro[3,4-dihydrochromene-2,4'-azepane]-4-amine is CCCN1CCCC2(CC1)CC(N)c1cc(Br)ccc1O2.
What is the InChIKey of 6-bromo-1'-propylspiro[3,4-dihydrochromene-2,4'-azepane]-4-amine?
The InChIKey is YOFTVRXODDBWQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25BrN2O/c1-2-8-20-9-3-6-17(7-10-20)12-15(19)14-11-13(18)4-5-16(14)21-17/h4-5,11,15H,2-3,6-10,12,19H2,1H3.
What are the key properties of 6-bromo-1'-propylspiro[3,4-dihydrochromene-2,4'-azepane]-4-amine?
6-bromo-1'-propylspiro[3,4-dihydrochromene-2,4'-azepane]-4-amine has a molecular weight of 353.30 g/mol, XLogP of 3.87, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-1'-propylspiro[3,4-dihydrochromene-2,4'-azepane]-4-amine is sourced from PubChem (CID 114710193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).