About 7-bromo-2-(ethoxymethyl)-2-methyl-N-propyl-3,4-dihydrochromen-4-amine
7-bromo-2-(ethoxymethyl)-2-methyl-N-propyl-3,4-dihydrochromen-4-amine (PubChem CID 114711924) has the molecular formula C16H24BrNO2
and a molecular weight of 342.28 g/mol. Its IUPAC name is 7-bromo-2-(ethoxymethyl)-2-methyl-N-propyl-3,4-dihydrochromen-4-amine.
Molecular Properties
| Compound Name | 7-bromo-2-(ethoxymethyl)-2-methyl-N-propyl-3,4-dihydrochromen-4-amine |
| PubChem CID | 114711924 |
| Molecular Formula | C16H24BrNO2 |
| Molecular Weight | 342.28 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 7-bromo-2-(ethoxymethyl)-2-methyl-N-propyl-3,4-dihydrochromen-4-amine |
| SMILES | CCCNC1CC(C)(COCC)Oc2cc(Br)ccc21 |
| InChI | InChI=1S/C16H24BrNO2/c1-4-8-18-14-10-16(3,11-19-5-2)20-15-9-12(17)6-7-13(14)15/h6-7,9,14,18H,4-5,8,10-11H2,1-3H3 |
| InChIKey | YOIXXRWRIKXHAR-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.28 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-bromo-2-(ethoxymethyl)-2-methyl-N-propyl-3,4-dihydrochromen-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-2-(ethoxymethyl)-2-methyl-N-propyl-3,4-dihydrochromen-4-amine?
The IUPAC name of 7-bromo-2-(ethoxymethyl)-2-methyl-N-propyl-3,4-dihydrochromen-4-amine (CID 114711924) is 7-bromo-2-(ethoxymethyl)-2-methyl-N-propyl-3,4-dihydrochromen-4-amine.
What is the SMILES notation for 7-bromo-2-(ethoxymethyl)-2-methyl-N-propyl-3,4-dihydrochromen-4-amine?
The canonical SMILES for 7-bromo-2-(ethoxymethyl)-2-methyl-N-propyl-3,4-dihydrochromen-4-amine is CCCNC1CC(C)(COCC)Oc2cc(Br)ccc21.
What is the InChIKey of 7-bromo-2-(ethoxymethyl)-2-methyl-N-propyl-3,4-dihydrochromen-4-amine?
The InChIKey is YOIXXRWRIKXHAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24BrNO2/c1-4-8-18-14-10-16(3,11-19-5-2)20-15-9-12(17)6-7-13(14)15/h6-7,9,14,18H,4-5,8,10-11H2,1-3H3.
What are the key properties of 7-bromo-2-(ethoxymethyl)-2-methyl-N-propyl-3,4-dihydrochromen-4-amine?
7-bromo-2-(ethoxymethyl)-2-methyl-N-propyl-3,4-dihydrochromen-4-amine has a molecular weight of 342.28 g/mol, XLogP of 4.07, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-2-(ethoxymethyl)-2-methyl-N-propyl-3,4-dihydrochromen-4-amine is sourced from PubChem (CID 114711924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).