C17H18BrNO — CID 114712518
2-(2-bromophenyl)-N,6-dimethyl-3,4-dihydro-2H-chromen-4-amine (PubChem CID 114712518) has the molecular formula C17H18BrNO and a molecular weight of 332.24 g/mol. Its IUPAC name is 2-(2-bromophenyl)-N,6-dimethyl-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | 2-(2-bromophenyl)-N,6-dimethyl-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 114712518 |
| Molecular Formula | C17H18BrNO |
| Molecular Weight | 332.24 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | 2-(2-bromophenyl)-N,6-dimethyl-3,4-dihydro-2H-chromen-4-amine |
| SMILES | CNC1CC(c2ccccc2Br)Oc2ccc(C)cc21 |
| InChI | InChI=1S/C17H18BrNO/c1-11-7-8-16-13(9-11)15(19-2)10-17(20-16)12-5-3-4-6-14(12)18/h3-9,15,17,19H,10H2,1-2H3 |
| InChIKey | UTGXBGJQKYENEM-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.24 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |