C13H8N2O3S — CID 11471260
3-(5-thiophen-2-yl-1,2,4-oxadiazol-3-yl)benzoic acid (PubChem CID 11471260) has the molecular formula C13H8N2O3S and a molecular weight of 272.29 g/mol. Its IUPAC name is 3-(5-thiophen-2-yl-1,2,4-oxadiazol-3-yl)benzoic acid.
| Compound Name | 3-(5-thiophen-2-yl-1,2,4-oxadiazol-3-yl)benzoic acid |
|---|---|
| PubChem CID | 11471260 |
| Molecular Formula | C13H8N2O3S |
| Molecular Weight | 272.29 g/mol |
| Exact Mass | 272.03 |
| IUPAC Name | 3-(5-thiophen-2-yl-1,2,4-oxadiazol-3-yl)benzoic acid |
| SMILES | O=C(O)c1cccc(-c2noc(-c3cccs3)n2)c1 |
| InChI | InChI=1S/C13H8N2O3S/c16-13(17)9-4-1-3-8(7-9)11-14-12(18-15-11)10-5-2-6-19-10/h1-7H,(H,16,17) |
| InChIKey | IKNFAOPFEAGWDX-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.29 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |