About (6R)-7-(1,3-dithian-2-ylidene)-4,6-dimethyloct-1-en-4-ol
(6R)-7-(1,3-dithian-2-ylidene)-4,6-dimethyloct-1-en-4-ol (PubChem CID 11471284) has the molecular formula C14H24OS2
and a molecular weight of 272.48 g/mol. Its IUPAC name is (6R)-7-(1,3-dithian-2-ylidene)-4,6-dimethyloct-1-en-4-ol.
Molecular Properties
| Compound Name | (6R)-7-(1,3-dithian-2-ylidene)-4,6-dimethyloct-1-en-4-ol |
| PubChem CID | 11471284 |
| Molecular Formula | C14H24OS2 |
| Molecular Weight | 272.48 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | (6R)-7-(1,3-dithian-2-ylidene)-4,6-dimethyloct-1-en-4-ol |
| SMILES | C=CCC(C)(O)C[C@@H](C)C(C)=C1SCCCS1 |
| InChI | InChI=1S/C14H24OS2/c1-5-7-14(4,15)10-11(2)12(3)13-16-8-6-9-17-13/h5,11,15H,1,6-10H2,2-4H3/t11-,14?/m1/s1 |
| InChIKey | MZBMFCOBBCPWAU-YNODCEANSA-N |
| XLogP | 4.44 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.48 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (6R)-7-(1,3-dithian-2-ylidene)-4,6-dimethyloct-1-en-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-7-(1,3-dithian-2-ylidene)-4,6-dimethyloct-1-en-4-ol?
The IUPAC name of (6R)-7-(1,3-dithian-2-ylidene)-4,6-dimethyloct-1-en-4-ol (CID 11471284) is (6R)-7-(1,3-dithian-2-ylidene)-4,6-dimethyloct-1-en-4-ol.
What is the SMILES notation for (6R)-7-(1,3-dithian-2-ylidene)-4,6-dimethyloct-1-en-4-ol?
The canonical SMILES for (6R)-7-(1,3-dithian-2-ylidene)-4,6-dimethyloct-1-en-4-ol is C=CCC(C)(O)C[C@@H](C)C(C)=C1SCCCS1.
What is the InChIKey of (6R)-7-(1,3-dithian-2-ylidene)-4,6-dimethyloct-1-en-4-ol?
The InChIKey is MZBMFCOBBCPWAU-YNODCEANSA-N. The full InChI is InChI=1S/C14H24OS2/c1-5-7-14(4,15)10-11(2)12(3)13-16-8-6-9-17-13/h5,11,15H,1,6-10H2,2-4H3/t11-,14?/m1/s1.
What are the key properties of (6R)-7-(1,3-dithian-2-ylidene)-4,6-dimethyloct-1-en-4-ol?
(6R)-7-(1,3-dithian-2-ylidene)-4,6-dimethyloct-1-en-4-ol has a molecular weight of 272.48 g/mol, XLogP of 4.44, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-7-(1,3-dithian-2-ylidene)-4,6-dimethyloct-1-en-4-ol is sourced from PubChem (CID 11471284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).