C15H20BrNOS — CID 114713382
6-bromo-N-ethylspiro[3,4-dihydrochromene-2,3'-thiane]-4-amine (PubChem CID 114713382) has the molecular formula C15H20BrNOS and a molecular weight of 342.30 g/mol. Its IUPAC name is 6-bromo-N-ethylspiro[3,4-dihydrochromene-2,3'-thiane]-4-amine.
| Compound Name | 6-bromo-N-ethylspiro[3,4-dihydrochromene-2,3'-thiane]-4-amine |
|---|---|
| PubChem CID | 114713382 |
| Molecular Formula | C15H20BrNOS |
| Molecular Weight | 342.30 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | 6-bromo-N-ethylspiro[3,4-dihydrochromene-2,3'-thiane]-4-amine |
| SMILES | CCNC1CC2(CCCSC2)Oc2ccc(Br)cc21 |
| InChI | InChI=1S/C15H20BrNOS/c1-2-17-13-9-15(6-3-7-19-10-15)18-14-5-4-11(16)8-12(13)14/h4-5,8,13,17H,2-3,6-7,9-10H2,1H3 |
| InChIKey | DJQMNTWYLCRSGQ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.30 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |