C14H12O6 — CID 11471374
ethyl 2,3,5-trihydroxy-6-oxobenzo[7]annulene-8-carboxylate (PubChem CID 11471374) has the molecular formula C14H12O6 and a molecular weight of 276.24 g/mol. Its IUPAC name is ethyl 2,3,5-trihydroxy-6-oxobenzo[7]annulene-8-carboxylate.
| Compound Name | ethyl 2,3,5-trihydroxy-6-oxobenzo[7]annulene-8-carboxylate |
|---|---|
| PubChem CID | 11471374 |
| Molecular Formula | C14H12O6 |
| Molecular Weight | 276.24 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | ethyl 2,3,5-trihydroxy-6-oxobenzo[7]annulene-8-carboxylate |
| SMILES | CCOC(=O)c1cc(=O)c(O)c2cc(O)c(O)cc2c1 |
| InChI | InChI=1S/C14H12O6/c1-2-20-14(19)8-3-7-4-10(15)11(16)6-9(7)13(18)12(17)5-8/h3-6,15-16H,2H2,1H3,(H,17,18) |
| InChIKey | GTPROVBMMOQGSS-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.24 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|