C17H19FN2O — CID 114713915
7-fluoro-N-propyl-2-pyridin-3-yl-3,4-dihydro-2H-chromen-4-amine (PubChem CID 114713915) has the molecular formula C17H19FN2O and a molecular weight of 286.35 g/mol. Its IUPAC name is 7-fluoro-N-propyl-2-pyridin-3-yl-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | 7-fluoro-N-propyl-2-pyridin-3-yl-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 114713915 |
| Molecular Formula | C17H19FN2O |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 7-fluoro-N-propyl-2-pyridin-3-yl-3,4-dihydro-2H-chromen-4-amine |
| SMILES | CCCNC1CC(c2cccnc2)Oc2cc(F)ccc21 |
| InChI | InChI=1S/C17H19FN2O/c1-2-7-20-15-10-16(12-4-3-8-19-11-12)21-17-9-13(18)5-6-14(15)17/h3-6,8-9,11,15-16,20H,2,7,10H2,1H3 |
| InChIKey | SYSFRJMTBINIFY-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |