C19H35N — CID 11471426
1-[(1E)-deca-1,9-dienyl]-2,2,6,6-tetramethylpiperidine (PubChem CID 11471426) has the molecular formula C19H35N and a molecular weight of 277.50 g/mol. Its IUPAC name is 1-[(1E)-deca-1,9-dienyl]-2,2,6,6-tetramethylpiperidine.
| Compound Name | 1-[(1E)-deca-1,9-dienyl]-2,2,6,6-tetramethylpiperidine |
|---|---|
| PubChem CID | 11471426 |
| Molecular Formula | C19H35N |
| Molecular Weight | 277.50 g/mol |
| Exact Mass | 277.28 |
| IUPAC Name | 1-[(1E)-deca-1,9-dienyl]-2,2,6,6-tetramethylpiperidine |
| SMILES | C=CCCCCCC/C=C/N1C(C)(C)CCCC1(C)C |
| InChI | InChI=1S/C19H35N/c1-6-7-8-9-10-11-12-13-17-20-18(2,3)15-14-16-19(20,4)5/h6,13,17H,1,7-12,14-16H2,2-5H3/b17-13+ |
| InChIKey | DIRYQZPPDMWWHN-GHRIWEEISA-N |
| XLogP | 6.07 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.50 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|