C16H22FNS — CID 11471491
(1R,9aR)-1-[(4-fluorophenyl)sulfanylmethyl]-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine (PubChem CID 11471491) has the molecular formula C16H22FNS and a molecular weight of 279.42 g/mol. Its IUPAC name is (1R,9aR)-1-[(4-fluorophenyl)sulfanylmethyl]-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine.
| Compound Name | (1R,9aR)-1-[(4-fluorophenyl)sulfanylmethyl]-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine |
|---|---|
| PubChem CID | 11471491 |
| Molecular Formula | C16H22FNS |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | (1R,9aR)-1-[(4-fluorophenyl)sulfanylmethyl]-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine |
| SMILES | Fc1ccc(SC[C@@H]2CCCN3CCCC[C@H]23)cc1 |
| InChI | InChI=1S/C16H22FNS/c17-14-6-8-15(9-7-14)19-12-13-4-3-11-18-10-2-1-5-16(13)18/h6-9,13,16H,1-5,10-12H2/t13-,16+/m0/s1 |
| InChIKey | IRDBTHBIRIGCIZ-XJKSGUPXSA-N |
| XLogP | 4.18 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |